C22H24F3N8O2+ — CID 121351663
(9S)-8-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide (PubChem CID 121351663) has the molecular formula C22H24F3N8O2+ and a molecular weight of 489.48 g/mol. Its IUPAC name is (9S)-8-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide.
| Compound Name | (9S)-8-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide |
|---|---|
| PubChem CID | 121351663 |
| Molecular Formula | C22H24F3N8O2+ |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (9S)-8-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide |
| SMILES | Cc1ccc2c(N3c4c(ccc[n+]4[C@H](C)C(F)(F)F)N4C[C@@H]3CC(C(N)=O)C4C(N)=O)n[nH]c2n1 |
| InChI | InChI=1S/C22H23F3N8O2/c1-10-5-6-13-19(28-10)29-30-20(13)33-12-8-14(17(26)34)16(18(27)35)32(9-12)15-4-3-7-31(21(15)33)11(2)22(23,24)25/h3-7,11-12,14,16H,8-9H2,1-2H3,(H4-,26,27,28,29,30,34,35)/p+1/t11-,12+,14?,16?/m1/s1 |
| InChIKey | GFDWFEJBADWRJN-SOURHHEESA-O |
| XLogP | 1.36 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|