C26H33F2N6O5+ — CID 121351695
(9S)-6-(2,2-difluoropropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide (PubChem CID 121351695) has the molecular formula C26H33F2N6O5+ and a molecular weight of 547.58 g/mol. Its IUPAC name is (9S)-6-(2,2-difluoropropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide.
| Compound Name | (9S)-6-(2,2-difluoropropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide |
|---|---|
| PubChem CID | 121351695 |
| Molecular Formula | C26H33F2N6O5+ |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | (9S)-6-(2,2-difluoropropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide |
| SMILES | CC(F)(F)C[n+]1cccc2c1N(c1cc(OC[C@H]3COC(C)(C)O3)ccn1)[C@H]1CC(C(N)=O)C(C(N)=O)N2C1 |
| InChI | InChI=1S/C26H32F2N6O5/c1-25(2)38-13-17(39-25)12-37-16-6-7-31-20(10-16)34-15-9-18(22(29)35)21(23(30)36)33(11-15)19-5-4-8-32(24(19)34)14-26(3,27)28/h4-8,10,15,17-18,21H,9,11-14H2,1-3H3,(H3-,29,30,35,36)/p+1/t15-,17-,18?,21?/m0/s1 |
| InChIKey | LJIXYJKIWBIZHY-PDORWXRYSA-O |
| XLogP | 1.24 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|