C23H28N6O6 — CID 121351881
methyl (9S)-8-[[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]carbamoyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5-carboxylate (PubChem CID 121351881) has the molecular formula C23H28N6O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is methyl (9S)-8-[[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]carbamoyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5-carboxylate.
| Compound Name | methyl (9S)-8-[[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]carbamoyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5-carboxylate |
|---|---|
| PubChem CID | 121351881 |
| Molecular Formula | C23H28N6O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl (9S)-8-[[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]carbamoyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5-carboxylate |
| SMILES | COC(=O)c1ncc2c(n1)N(C(=O)Nc1ccc(OCC3COC(C)(C)O3)cn1)[C@H]1CCCN2C1 |
| InChI | InChI=1S/C23H28N6O6/c1-23(2)34-13-16(35-23)12-33-15-6-7-18(24-9-15)26-22(31)29-14-5-4-8-28(11-14)17-10-25-19(21(30)32-3)27-20(17)29/h6-7,9-10,14,16H,4-5,8,11-13H2,1-3H3,(H,24,26,31)/t14-,16?/m0/s1 |
| InChIKey | IHMPNIOGPSJHJB-LBAUFKAWSA-N |
| XLogP | 2.21 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |