C23H22F3N7O4 — CID 121351901
(9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide (PubChem CID 121351901) has the molecular formula C23H22F3N7O4 and a molecular weight of 517.47 g/mol. Its IUPAC name is (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide.
| Compound Name | (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide |
|---|---|
| PubChem CID | 121351901 |
| Molecular Formula | C23H22F3N7O4 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide |
| SMILES | O=C(Nc1ncc(OC[C@@H](O)CO)cn1)C1C[C@H]2CN1c1cnc(-c3cccc(C(F)(F)F)c3)nc1N2 |
| InChI | InChI=1S/C23H22F3N7O4/c24-23(25,26)13-3-1-2-12(4-13)19-27-8-18-20(31-19)30-14-5-17(33(18)9-14)21(36)32-22-28-6-16(7-29-22)37-11-15(35)10-34/h1-4,6-8,14-15,17,34-35H,5,9-11H2,(H,27,30,31)(H,28,29,32,36)/t14-,15-,17?/m0/s1 |
| InChIKey | CLCNYAZPZRYBCM-GIIGEWEBSA-N |
| XLogP | 1.70 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |