C18H19N5O3 — CID 121351918
methyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate (PubChem CID 121351918) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is methyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate.
| Compound Name | methyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate |
|---|---|
| PubChem CID | 121351918 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCCN2C1 |
| InChI | InChI=1S/C18H19N5O3/c1-26-17(24)13-7-8-14-16(20-13)23(12-5-4-10-22(14)11-12)18(25)21-15-6-2-3-9-19-15/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,19,21,25)/t12-/m0/s1 |
| InChIKey | MZXQBFXORIDLPJ-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |