C23H44F6N4O6P+ — CID 121351945
1,3-bis[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]propan-2-yloxy-bis[di(propan-2-yl)amino]-hydroxyphosphanium (PubChem CID 121351945) has the molecular formula C23H44F6N4O6P+ and a molecular weight of 617.59 g/mol. Its IUPAC name is 1,3-bis[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]propan-2-yloxy-bis[di(propan-2-yl)amino]-hydroxyphosphanium.
| Compound Name | 1,3-bis[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]propan-2-yloxy-bis[di(propan-2-yl)amino]-hydroxyphosphanium |
|---|---|
| PubChem CID | 121351945 |
| Molecular Formula | C23H44F6N4O6P+ |
| Molecular Weight | 617.59 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 1,3-bis[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]propan-2-yloxy-bis[di(propan-2-yl)amino]-hydroxyphosphanium |
| SMILES | CC(C)N(C(C)C)[P+](O)(OC(COCCNC(=O)C(F)(F)F)COCCNC(=O)C(F)(F)F)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H43F6N4O6P/c1-15(2)32(16(3)4)40(36,33(17(5)6)18(7)8)39-19(13-37-11-9-30-20(34)22(24,25)26)14-38-12-10-31-21(35)23(27,28)29/h15-19,36H,9-14H2,1-8H3,(H-,30,31,34,35)/p+1 |
| InChIKey | QZBUAXBPNSQPBW-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|