C24H23F3N6O4 — CID 121351978
N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121351978) has the molecular formula C24H23F3N6O4 and a molecular weight of 516.48 g/mol. Its IUPAC name is N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121351978 |
| Molecular Formula | C24H23F3N6O4 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(O)CO)cn1)N1c2nc(-c3cccc(C(F)(F)F)c3)ncc2N2CCC1C2 |
| InChI | InChI=1S/C24H23F3N6O4/c25-24(26,27)15-3-1-2-14(8-15)21-29-10-19-22(31-21)33(16-6-7-32(19)11-16)23(36)30-20-5-4-18(9-28-20)37-13-17(35)12-34/h1-5,8-10,16-17,34-35H,6-7,11-13H2,(H,28,30,36) |
| InChIKey | ZKJILWXAJPGXLH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |