C24H23F3N6O4 — CID 121352011
(9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide (PubChem CID 121352011) has the molecular formula C24H23F3N6O4 and a molecular weight of 516.48 g/mol. Its IUPAC name is (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide.
| Compound Name | (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide |
|---|---|
| PubChem CID | 121352011 |
| Molecular Formula | C24H23F3N6O4 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide |
| SMILES | O=C(Nc1cncc(OC[C@@H](O)CO)c1)C1C[C@H]2CN1c1cnc(-c3cccc(C(F)(F)F)c3)nc1N2 |
| InChI | InChI=1S/C24H23F3N6O4/c25-24(26,27)14-3-1-2-13(4-14)21-29-9-20-22(32-21)30-16-6-19(33(20)10-16)23(36)31-15-5-18(8-28-7-15)37-12-17(35)11-34/h1-5,7-9,16-17,19,34-35H,6,10-12H2,(H,31,36)(H,29,30,32)/t16-,17-,19?/m0/s1 |
| InChIKey | WDHRDISEWRCHFI-YGYNJSFOSA-N |
| XLogP | 2.30 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |