C22H22F3N8O3+ — CID 121352079
(9S)-8-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,8-triaza-6-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxamide (PubChem CID 121352079) has the molecular formula C22H22F3N8O3+ and a molecular weight of 503.47 g/mol. Its IUPAC name is (9S)-8-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,8-triaza-6-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxamide.
| Compound Name | (9S)-8-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,8-triaza-6-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxamide |
|---|---|
| PubChem CID | 121352079 |
| Molecular Formula | C22H22F3N8O3+ |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | (9S)-8-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-6-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,8-triaza-6-azoniatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxamide |
| SMILES | Cc1ncc(-c2ccnc(N3c4c(cnc[n+]4[C@H](C)C(F)(F)F)N4C[C@@H]3C(C(N)=O)C4C(N)=O)c2)o1 |
| InChI | InChI=1S/C22H21F3N8O3/c1-10(22(23,24)25)32-9-28-6-13-21(32)33(14-8-31(13)18(20(27)35)17(14)19(26)34)16-5-12(3-4-29-16)15-7-30-11(2)36-15/h3-7,9-10,14,17-18H,8H2,1-2H3,(H3-,26,27,34,35)/p+1/t10-,14-,17?,18?/m1/s1 |
| InChIKey | IYIKNWGAVPNAPS-SANLESKHSA-O |
| XLogP | 1.15 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|