C19H20F3N7O2 — CID 121352149
(9S)-8-N-(4-amino-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352149) has the molecular formula C19H20F3N7O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is (9S)-8-N-(4-amino-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(4-amino-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352149 |
| Molecular Formula | C19H20F3N7O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (9S)-8-N-(4-amino-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CC(NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(N)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3N7O2/c1-10(19(20,21)22)25-17(30)13-2-3-14-16(26-13)29(12-5-7-28(14)9-12)18(31)27-15-8-11(23)4-6-24-15/h2-4,6,8,10,12H,5,7,9H2,1H3,(H,25,30)(H3,23,24,27,31)/t10?,12-/m0/s1 |
| InChIKey | OYLNWJQUNWFLAH-KFJBMODSSA-N |
| XLogP | 2.37 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |