C20H20F4N6O2 — CID 121352157
8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352157) has the molecular formula C20H20F4N6O2 and a molecular weight of 452.41 g/mol. Its IUPAC name is 8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352157 |
| Molecular Formula | C20H20F4N6O2 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CC[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1ccc(F)cn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H20F4N6O2/c1-2-15(20(22,23)24)27-18(31)13-4-5-14-17(26-13)30(12-7-8-29(14)10-12)19(32)28-16-6-3-11(21)9-25-16/h3-6,9,12,15H,2,7-8,10H2,1H3,(H,27,31)(H,25,28,32)/t12?,15-/m1/s1 |
| InChIKey | HLJYPCWKGPJLBN-WPZCJLIBSA-N |
| XLogP | 3.32 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |