C22H21F3N8O2 — CID 121352178
(9S)-8-N-[4-(1H-pyrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352178) has the molecular formula C22H21F3N8O2 and a molecular weight of 486.46 g/mol. Its IUPAC name is (9S)-8-N-[4-(1H-pyrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-[4-(1H-pyrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352178 |
| Molecular Formula | C22H21F3N8O2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (9S)-8-N-[4-(1H-pyrazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(-c3ccn[nH]3)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N8O2/c1-12(22(23,24)25)28-20(34)16-2-3-17-19(29-16)33(14-6-9-32(17)11-14)21(35)30-18-10-13(4-7-26-18)15-5-8-27-31-15/h2-5,7-8,10,12,14H,6,9,11H2,1H3,(H,27,31)(H,28,34)(H,26,30,35)/t12-,14+/m1/s1 |
| InChIKey | QKXAVLHDCRERNS-OCCSQVGLSA-N |
| XLogP | 3.18 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |