C21H23F3N6O2 — CID 121352202
8-N-(5-propan-2-yl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352202) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 8-N-(5-propan-2-yl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(5-propan-2-yl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352202 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 8-N-(5-propan-2-yl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)N2c3nc(C(=O)NCC(F)(F)F)ccc3N3CCC2C3)nc1 |
| InChI | InChI=1S/C21H23F3N6O2/c1-12(2)13-3-6-17(25-9-13)28-20(32)30-14-7-8-29(10-14)16-5-4-15(27-18(16)30)19(31)26-11-21(22,23)24/h3-6,9,12,14H,7-8,10-11H2,1-2H3,(H,26,31)(H,25,28,32) |
| InChIKey | PSCLTIAORDOPDZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |