C20H19F3N6O4 — CID 121352204
methyl 2-[[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate (PubChem CID 121352204) has the molecular formula C20H19F3N6O4 and a molecular weight of 464.40 g/mol. Its IUPAC name is methyl 2-[[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate.
| Compound Name | methyl 2-[[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 121352204 |
| Molecular Formula | C20H19F3N6O4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 2-[[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(NC(=O)N2c3nc(C(=O)NCC(F)(F)F)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C20H19F3N6O4/c1-33-18(31)11-4-6-24-15(8-11)27-19(32)29-12-5-7-28(9-12)14-3-2-13(26-16(14)29)17(30)25-10-20(21,22)23/h2-4,6,8,12H,5,7,9-10H2,1H3,(H,25,30)(H,24,27,32)/t12-/m0/s1 |
| InChIKey | IMFQXYHJKOGMOJ-LBPRGKRZSA-N |
| XLogP | 2.19 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |