C26H31F3N6O5 — CID 121352206
(9S)-8-N-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352206) has the molecular formula C26H31F3N6O5 and a molecular weight of 564.57 g/mol. Its IUPAC name is (9S)-8-N-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352206 |
| Molecular Formula | C26H31F3N6O5 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (9S)-8-N-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(OCCOC3CCCCO3)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N6O5/c1-16(26(27,28)29)31-24(36)19-5-6-20-23(32-19)35(17-8-10-34(20)15-17)25(37)33-21-14-18(7-9-30-21)38-12-13-40-22-4-2-3-11-39-22/h5-7,9,14,16-17,22H,2-4,8,10-13,15H2,1H3,(H,31,36)(H,30,33,37)/t16-,17+,22?/m1/s1 |
| InChIKey | CQZHCFDHYRHAIE-KDPSSXBDSA-N |
| XLogP | 3.71 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|