C20H21F3N6O2 — CID 121352212
(9S)-8-N-(5-methyl-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352212) has the molecular formula C20H21F3N6O2 and a molecular weight of 434.42 g/mol. Its IUPAC name is (9S)-8-N-(5-methyl-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(5-methyl-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352212 |
| Molecular Formula | C20H21F3N6O2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (9S)-8-N-(5-methyl-2-pyridinyl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)N2c3nc(C(=O)NC(C)C(F)(F)F)ccc3N3CC[C@H]2C3)nc1 |
| InChI | InChI=1S/C20H21F3N6O2/c1-11-3-6-16(24-9-11)27-19(31)29-13-7-8-28(10-13)15-5-4-14(26-17(15)29)18(30)25-12(2)20(21,22)23/h3-6,9,12-13H,7-8,10H2,1-2H3,(H,25,30)(H,24,27,31)/t12?,13-/m0/s1 |
| InChIKey | KZSIENQINCGVIT-ABLWVSNPSA-N |
| XLogP | 3.10 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |