C20H19F3N4O3 — CID 121352214
phenyl (9S)-5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate (PubChem CID 121352214) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is phenyl (9S)-5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate.
| Compound Name | phenyl (9S)-5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
|---|---|
| PubChem CID | 121352214 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | phenyl (9S)-5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Oc1ccccc1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O3/c1-12(20(21,22)23)24-18(28)15-7-8-16-17(25-15)27(13-9-10-26(16)11-13)19(29)30-14-5-3-2-4-6-14/h2-8,12-13H,9-11H2,1H3,(H,24,28)/t12-,13+/m1/s1 |
| InChIKey | JGVSKAJOMMJADU-OLZOCXBDSA-N |
| XLogP | 3.36 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |