C18H18F3N7O2 — CID 121352222
(9S)-8-N-(4-amino-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352222) has the molecular formula C18H18F3N7O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is (9S)-8-N-(4-amino-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(4-amino-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352222 |
| Molecular Formula | C18H18F3N7O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (9S)-8-N-(4-amino-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Nc1ccnc(NC(=O)N2c3nc(C(=O)NCC(F)(F)F)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C18H18F3N7O2/c19-18(20,21)9-24-16(29)12-1-2-13-15(25-12)28(11-4-6-27(13)8-11)17(30)26-14-7-10(22)3-5-23-14/h1-3,5,7,11H,4,6,8-9H2,(H,24,29)(H3,22,23,26,30)/t11-/m0/s1 |
| InChIKey | XNRIZACLQPJNQE-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |