C22H27F3N6O5 — CID 121352236
(9S)-8-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide (PubChem CID 121352236) has the molecular formula C22H27F3N6O5 and a molecular weight of 512.49 g/mol. Its IUPAC name is (9S)-8-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352236 |
| Molecular Formula | C22H27F3N6O5 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (9S)-8-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)C1C=CC2=C(N1)N(C(=O)Nc1cccc(OC[C@H](O)CO)n1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H27F3N6O5/c1-12(22(23,24)25)26-20(34)15-5-6-16-19(27-15)31(13-7-8-30(16)9-13)21(35)29-17-3-2-4-18(28-17)36-11-14(33)10-32/h2-6,12-15,27,32-33H,7-11H2,1H3,(H,26,34)(H,28,29,35)/t12-,13+,14-,15?/m1/s1 |
| InChIKey | XNOUHGFKSLIBDV-PEUVFPKISA-N |
| XLogP | 0.50 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |