C22H25F3N6O5 — CID 121352316
(9S)-8-N-[4-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352316) has the molecular formula C22H25F3N6O5 and a molecular weight of 510.47 g/mol. Its IUPAC name is (9S)-8-N-[4-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-[4-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352316 |
| Molecular Formula | C22H25F3N6O5 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (9S)-8-N-[4-(2,3-dihydroxypropoxy)-2-pyridinyl]-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CC(NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(OCC(O)CO)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3N6O5/c1-12(22(23,24)25)27-20(34)16-2-3-17-19(28-16)31(13-5-7-30(17)9-13)21(35)29-18-8-15(4-6-26-18)36-11-14(33)10-32/h2-4,6,8,12-14,32-33H,5,7,9-11H2,1H3,(H,27,34)(H,26,29,35)/t12?,13-,14?/m0/s1 |
| InChIKey | GSAWKGIQQMIAEF-MOKVOYLWSA-N |
| XLogP | 1.52 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |