C22H28N6O5 — CID 121352321
8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-prop-2-enyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide (PubChem CID 121352321) has the molecular formula C22H28N6O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-prop-2-enyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-prop-2-enyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352321 |
| Molecular Formula | C22H28N6O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-prop-2-enyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
| SMILES | C=CCNC(=O)C1C=CC2=C(N1)N(C(=O)Nc1cc(OC[C@H](O)CO)ccn1)C1CCN2C1 |
| InChI | InChI=1S/C22H28N6O5/c1-2-7-24-21(31)17-3-4-18-20(25-17)28(14-6-9-27(18)11-14)22(32)26-19-10-16(5-8-23-19)33-13-15(30)12-29/h2-5,8,10,14-15,17,25,29-30H,1,6-7,9,11-13H2,(H,24,31)(H,23,26,32)/t14?,15-,17?/m1/s1 |
| InChIKey | QTTUOCPTTMWSOG-ISXOHVOVSA-N |
| XLogP | -0.27 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|