C25H26F3N7O2S — CID 121352331
8-N-[4-(2-cyclopropyl-1,3-thiazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide (PubChem CID 121352331) has the molecular formula C25H26F3N7O2S and a molecular weight of 545.59 g/mol. Its IUPAC name is 8-N-[4-(2-cyclopropyl-1,3-thiazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2-cyclopropyl-1,3-thiazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352331 |
| Molecular Formula | C25H26F3N7O2S |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 8-N-[4-(2-cyclopropyl-1,3-thiazol-5-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)C1C=CC2=C(N1)N(C(=O)Nc1cc(-c3cnc(C4CC4)s3)ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C25H26F3N7O2S/c1-13(25(26,27)28)31-22(36)17-4-5-18-21(32-17)35(16-7-9-34(18)12-16)24(37)33-20-10-15(6-8-29-20)19-11-30-23(38-19)14-2-3-14/h4-6,8,10-11,13-14,16-17,32H,2-3,7,9,12H2,1H3,(H,31,36)(H,29,33,37)/t13-,16?,17?/m1/s1 |
| InChIKey | PIVWJZYCEGLCAS-NVPAJSRCSA-N |
| XLogP | 3.77 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |