C22H26F2N6O5 — CID 121352334
5-N-(2,2-difluoropropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352334) has the molecular formula C22H26F2N6O5 and a molecular weight of 492.48 g/mol. Its IUPAC name is 5-N-(2,2-difluoropropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 5-N-(2,2-difluoropropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352334 |
| Molecular Formula | C22H26F2N6O5 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5-N-(2,2-difluoropropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CC(F)(F)CNC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(OC[C@H](O)CO)ccn1)C1CCN2C1 |
| InChI | InChI=1S/C22H26F2N6O5/c1-22(23,24)12-26-20(33)16-2-3-17-19(27-16)30(13-5-7-29(17)9-13)21(34)28-18-8-15(4-6-25-18)35-11-14(32)10-31/h2-4,6,8,13-14,31-32H,5,7,9-12H2,1H3,(H,26,33)(H,25,28,34)/t13?,14-/m1/s1 |
| InChIKey | VXJFPONLJFMKEW-ARLHGKGLSA-N |
| XLogP | 1.22 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |