C22H20F3N7O3 — CID 121352376
8-N-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352376) has the molecular formula C22H20F3N7O3 and a molecular weight of 487.44 g/mol. Its IUPAC name is 8-N-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352376 |
| Molecular Formula | C22H20F3N7O3 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 8-N-[4-(2-methyl-1,3-oxazol-5-yl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1ncc(-c2ccnc(NC(=O)N3c4nc(C(=O)NCC(F)(F)F)ccc4N4CCC3C4)c2)o1 |
| InChI | InChI=1S/C22H20F3N7O3/c1-12-27-9-17(35-12)13-4-6-26-18(8-13)30-21(34)32-14-5-7-31(10-14)16-3-2-15(29-19(16)32)20(33)28-11-22(23,24)25/h2-4,6,8-9,14H,5,7,10-11H2,1H3,(H,28,33)(H,26,30,34) |
| InChIKey | SHJBPGNMCQZODA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |