C20H22F3N7O5 — CID 121352412
8-N-[5-[(2R)-2,3-dihydroxypropoxy]pyrazin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352412) has the molecular formula C20H22F3N7O5 and a molecular weight of 497.43 g/mol. Its IUPAC name is 8-N-[5-[(2R)-2,3-dihydroxypropoxy]pyrazin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[5-[(2R)-2,3-dihydroxypropoxy]pyrazin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352412 |
| Molecular Formula | C20H22F3N7O5 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 8-N-[5-[(2R)-2,3-dihydroxypropoxy]pyrazin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1cnc(OC[C@H](O)CO)cn1)C1CCN2C1 |
| InChI | InChI=1S/C20H22F3N7O5/c21-20(22,23)10-26-18(33)13-1-2-14-17(27-13)30(11-3-4-29(14)7-11)19(34)28-15-5-25-16(6-24-15)35-9-12(32)8-31/h1-2,5-6,11-12,31-32H,3-4,7-10H2,(H,26,33)(H,24,28,34)/t11?,12-/m1/s1 |
| InChIKey | YORHSZQZLRPYGT-PIJUOVFKSA-N |
| XLogP | 0.53 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |