C21H20F3N9O2 — CID 121352468
8-N-[4-(triazol-1-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352468) has the molecular formula C21H20F3N9O2 and a molecular weight of 487.45 g/mol. Its IUPAC name is 8-N-[4-(triazol-1-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(triazol-1-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352468 |
| Molecular Formula | C21H20F3N9O2 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 8-N-[4-(triazol-1-yl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(-n3ccnn3)ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C21H20F3N9O2/c1-12(21(22,23)24)27-19(34)15-2-3-16-18(28-15)33(14-5-8-31(16)11-14)20(35)29-17-10-13(4-6-25-17)32-9-7-26-30-32/h2-4,6-7,9-10,12,14H,5,8,11H2,1H3,(H,27,34)(H,25,29,35)/t12-,14?/m1/s1 |
| InChIKey | LZYXPQJUGGEEMS-PUODRLBUSA-N |
| XLogP | 2.37 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |