C18H16F4N6O2 — CID 121352471
8-N-(5-fluoro-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352471) has the molecular formula C18H16F4N6O2 and a molecular weight of 424.36 g/mol. Its IUPAC name is 8-N-(5-fluoro-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(5-fluoro-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352471 |
| Molecular Formula | C18H16F4N6O2 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 8-N-(5-fluoro-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1ccc(F)cn1)C1CCN2C1 |
| InChI | InChI=1S/C18H16F4N6O2/c19-10-1-4-14(23-7-10)26-17(30)28-11-5-6-27(8-11)13-3-2-12(25-15(13)28)16(29)24-9-18(20,21)22/h1-4,7,11H,5-6,8-9H2,(H,24,29)(H,23,26,30) |
| InChIKey | JSHOLTZNNSXNTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |