C17H16FN5O3 — CID 121352479
(9S)-8-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid (PubChem CID 121352479) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is (9S)-8-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid.
| Compound Name | (9S)-8-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 121352479 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (9S)-8-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
| SMILES | Cc1cc(NC(=O)N2c3nc(C(=O)O)ccc3N3CC[C@H]2C3)ncc1F |
| InChI | InChI=1S/C17H16FN5O3/c1-9-6-14(19-7-11(9)18)21-17(26)23-10-4-5-22(8-10)13-3-2-12(16(24)25)20-15(13)23/h2-3,6-7,10H,4-5,8H2,1H3,(H,24,25)(H,19,21,26)/t10-/m0/s1 |
| InChIKey | GZIYBNMXRLYLAD-JTQLQIEISA-N |
| XLogP | 2.25 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |