C17H16BrN5O3 — CID 121352497
methyl (9S)-8-[(4-bromo-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate (PubChem CID 121352497) has the molecular formula C17H16BrN5O3 and a molecular weight of 418.25 g/mol. Its IUPAC name is methyl (9S)-8-[(4-bromo-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate.
| Compound Name | methyl (9S)-8-[(4-bromo-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
|---|---|
| PubChem CID | 121352497 |
| Molecular Formula | C17H16BrN5O3 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | methyl (9S)-8-[(4-bromo-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(Br)ccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C17H16BrN5O3/c1-26-16(24)12-2-3-13-15(20-12)23(11-5-7-22(13)9-11)17(25)21-14-8-10(18)4-6-19-14/h2-4,6,8,11H,5,7,9H2,1H3,(H,19,21,25)/t11-/m0/s1 |
| InChIKey | XHGSDGLBBWLSAB-NSHDSACASA-N |
| XLogP | 2.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |