C18H17N7O3 — CID 121352529
(9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid (PubChem CID 121352529) has the molecular formula C18H17N7O3 and a molecular weight of 379.38 g/mol. Its IUPAC name is (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid.
| Compound Name | (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 121352529 |
| Molecular Formula | C18H17N7O3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
| SMILES | Cc1ccc2c(NC(=O)N3c4nc(C(=O)O)ccc4N4CC[C@H]3C4)n[nH]c2n1 |
| InChI | InChI=1S/C18H17N7O3/c1-9-2-3-11-14(19-9)22-23-15(11)21-18(28)25-10-6-7-24(8-10)13-5-4-12(17(26)27)20-16(13)25/h2-5,10H,6-8H2,1H3,(H,26,27)(H2,19,21,22,23,28)/t10-/m0/s1 |
| InChIKey | GLOMHURVPFMDRG-JTQLQIEISA-N |
| XLogP | 1.99 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |