C17H15F2N5O3 — CID 121352623
methyl 7-[(3,5-difluoro-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylate (PubChem CID 121352623) has the molecular formula C17H15F2N5O3 and a molecular weight of 375.34 g/mol. Its IUPAC name is methyl 7-[(3,5-difluoro-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylate.
| Compound Name | methyl 7-[(3,5-difluoro-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylate |
|---|---|
| PubChem CID | 121352623 |
| Molecular Formula | C17H15F2N5O3 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | methyl 7-[(3,5-difluoro-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)N(C(=O)Nc1ncc(F)cc1F)CC1CC1N2 |
| InChI | InChI=1S/C17H15F2N5O3/c1-27-16(25)12-3-2-11-15(22-12)24(7-8-4-13(8)21-11)17(26)23-14-10(19)5-9(18)6-20-14/h2-3,5-6,8,13,21H,4,7H2,1H3,(H,20,23,26) |
| InChIKey | MFOXVLLXSLSGEA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |