C21H19F3N8O3 — CID 121352645
(9S)-8-N-[4-(2-methyl-1,3-oxazol-5-yl)pyrimidin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352645) has the molecular formula C21H19F3N8O3 and a molecular weight of 488.43 g/mol. Its IUPAC name is (9S)-8-N-[4-(2-methyl-1,3-oxazol-5-yl)pyrimidin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-[4-(2-methyl-1,3-oxazol-5-yl)pyrimidin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352645 |
| Molecular Formula | C21H19F3N8O3 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (9S)-8-N-[4-(2-methyl-1,3-oxazol-5-yl)pyrimidin-2-yl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1ncc(-c2ccnc(NC(=O)N3c4nc(C(=O)NCC(F)(F)F)ccc4N4CC[C@H]3C4)n2)o1 |
| InChI | InChI=1S/C21H19F3N8O3/c1-11-26-8-16(35-11)13-4-6-25-19(29-13)30-20(34)32-12-5-7-31(9-12)15-3-2-14(28-17(15)32)18(33)27-10-21(22,23)24/h2-4,6,8,12H,5,7,9-10H2,1H3,(H,27,33)(H,25,29,30,34)/t12-/m0/s1 |
| InChIKey | WAYXCYDHTKDIDM-LBPRGKRZSA-N |
| XLogP | 2.76 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |