C22H23F3N6O3 — CID 121352684
8-N-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352684) has the molecular formula C22H23F3N6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is 8-N-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352684 |
| Molecular Formula | C22H23F3N6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 8-N-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc3c(cn1)OCCC3)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H23F3N6O3/c1-12(22(23,24)25)27-20(32)15-4-5-16-19(28-15)31(14-6-7-30(16)11-14)21(33)29-18-9-13-3-2-8-34-17(13)10-26-18/h4-5,9-10,12,14H,2-3,6-8,11H2,1H3,(H,27,32)(H,26,29,33)/t12-,14?/m1/s1 |
| InChIKey | JHTAGVDRYJNNFS-PUODRLBUSA-N |
| XLogP | 3.11 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |