C20H21F3N6O4 — CID 121352714
8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352714) has the molecular formula C20H21F3N6O4 and a molecular weight of 466.42 g/mol. Its IUPAC name is 8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352714 |
| Molecular Formula | C20H21F3N6O4 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 8-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1cc(OCCO)ccn1)C1CCN2C1 |
| InChI | InChI=1S/C20H21F3N6O4/c21-20(22,23)11-25-18(31)14-1-2-15-17(26-14)29(12-4-6-28(15)10-12)19(32)27-16-9-13(3-5-24-16)33-8-7-30/h1-3,5,9,12,30H,4,6-8,10-11H2,(H,25,31)(H,24,27,32) |
| InChIKey | CNHSCRKEVDAPQB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |