About 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine
8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine (PubChem CID 121353093) has the molecular formula C18H23N7O2S
and a molecular weight of 401.50 g/mol. Its IUPAC name is 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine.
Molecular Properties
| Compound Name | 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine |
| PubChem CID | 121353093 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine |
| SMILES | CCNCCn1c(Sc2cc3c(cc2N(C)C)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H23N7O2S/c1-4-20-5-6-25-17-15(16(19)21-9-22-17)23-18(25)28-14-8-13-12(26-10-27-13)7-11(14)24(2)3/h7-9,20H,4-6,10H2,1-3H3,(H2,19,21,22) |
| InChIKey | NGSVKWBYZJWHAU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine?
The IUPAC name of 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine (CID 121353093) is 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine.
What is the SMILES notation for 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine?
The canonical SMILES for 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine is CCNCCn1c(Sc2cc3c(cc2N(C)C)OCO3)nc2c(N)ncnc21.
What is the InChIKey of 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine?
The InChIKey is NGSVKWBYZJWHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N7O2S/c1-4-20-5-6-25-17-15(16(19)21-9-22-17)23-18(25)28-14-8-13-12(26-10-27-13)7-11(14)24(2)3/h7-9,20H,4-6,10H2,1-3H3,(H2,19,21,22).
What are the key properties of 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine?
8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine has a molecular weight of 401.50 g/mol, XLogP of 1.96, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(ethylamino)ethyl]purin-6-amine is sourced from PubChem (CID 121353093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).