About 3,4,5-trimethyl-6,7-dihydrothiazepine
3,4,5-trimethyl-6,7-dihydrothiazepine (PubChem CID 121354022) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 3,4,5-trimethyl-6,7-dihydrothiazepine.
Molecular Properties
| Compound Name | 3,4,5-trimethyl-6,7-dihydrothiazepine |
| PubChem CID | 121354022 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3,4,5-trimethyl-6,7-dihydrothiazepine |
| SMILES | CC1=NSCCC(C)=C1C |
| InChI | InChI=1S/C8H13NS/c1-6-4-5-10-9-8(3)7(6)2/h4-5H2,1-3H3 |
| InChIKey | QLTWBWSCJSGHQP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trimethyl-6,7-dihydrothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethyl-6,7-dihydrothiazepine?
The IUPAC name of 3,4,5-trimethyl-6,7-dihydrothiazepine (CID 121354022) is 3,4,5-trimethyl-6,7-dihydrothiazepine.
What is the SMILES notation for 3,4,5-trimethyl-6,7-dihydrothiazepine?
The canonical SMILES for 3,4,5-trimethyl-6,7-dihydrothiazepine is CC1=NSCCC(C)=C1C.
What is the InChIKey of 3,4,5-trimethyl-6,7-dihydrothiazepine?
The InChIKey is QLTWBWSCJSGHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-6-4-5-10-9-8(3)7(6)2/h4-5H2,1-3H3.
What are the key properties of 3,4,5-trimethyl-6,7-dihydrothiazepine?
3,4,5-trimethyl-6,7-dihydrothiazepine has a molecular weight of 155.27 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethyl-6,7-dihydrothiazepine is sourced from PubChem (CID 121354022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).