C13H18N2O2 — CID 121354391
(3E)-3-acetamido-N-[(2E)-penta-2,4-dien-2-yl]hexa-3,5-dienamide (PubChem CID 121354391) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3E)-3-acetamido-N-[(2E)-penta-2,4-dien-2-yl]hexa-3,5-dienamide.
| Compound Name | (3E)-3-acetamido-N-[(2E)-penta-2,4-dien-2-yl]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 121354391 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (3E)-3-acetamido-N-[(2E)-penta-2,4-dien-2-yl]hexa-3,5-dienamide |
| SMILES | C=C/C=C(\C)NC(=O)C/C(=C\C=C)NC(C)=O |
| InChI | InChI=1S/C13H18N2O2/c1-5-7-10(3)14-13(17)9-12(8-6-2)15-11(4)16/h5-8H,1-2,9H2,3-4H3,(H,14,17)(H,15,16)/b10-7+,12-8+ |
| InChIKey | LSUYZDBZYYEFIC-SMTGYRLFSA-N |
| XLogP | 1.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|