C19H35N5O5 — CID 121355115
2-[[4,6-bis[ethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]oxy]ethyl 2,2-dimethylbutanoate (PubChem CID 121355115) has the molecular formula C19H35N5O5 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[[4,6-bis[ethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]oxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[4,6-bis[ethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]oxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121355115 |
| Molecular Formula | C19H35N5O5 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 2-[[4,6-bis[ethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]oxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCN(COC)c1nc(OCCOC(=O)C(C)(C)CC)nc(N(CC)COC)n1 |
| InChI | InChI=1S/C19H35N5O5/c1-8-19(4,5)15(25)28-11-12-29-18-21-16(23(9-2)13-26-6)20-17(22-18)24(10-3)14-27-7/h8-14H2,1-7H3 |
| InChIKey | BJNGXBMJJJXKTC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|