C17H21F3O7 — CID 121355185
[1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 4-oxocyclohexane-1-carboxylate (PubChem CID 121355185) has the molecular formula C17H21F3O7 and a molecular weight of 394.34 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 4-oxocyclohexane-1-carboxylate.
| Compound Name | [1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 121355185 |
| Molecular Formula | C17H21F3O7 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [1,1,1-trifluoro-2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropan-2-yl] 4-oxocyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(C)(OC(=O)C1CCC(=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O7/c1-10(2)13(22)25-8-9-26-15(24)16(3,17(18,19)20)27-14(23)11-4-6-12(21)7-5-11/h11H,1,4-9H2,2-3H3 |
| InChIKey | AJIHVWCEIAYPFQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|