C12H22O2 — CID 121355244
(3S,4S,6S)-2,3,4,5-tetramethyl-6-[(Z)-prop-1-enoxy]oxane (PubChem CID 121355244) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (3S,4S,6S)-2,3,4,5-tetramethyl-6-[(Z)-prop-1-enoxy]oxane.
| Compound Name | (3S,4S,6S)-2,3,4,5-tetramethyl-6-[(Z)-prop-1-enoxy]oxane |
|---|---|
| PubChem CID | 121355244 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (3S,4S,6S)-2,3,4,5-tetramethyl-6-[(Z)-prop-1-enoxy]oxane |
| SMILES | C/C=C\O[C@H]1OC(C)[C@@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C12H22O2/c1-6-7-13-12-10(4)8(2)9(3)11(5)14-12/h6-12H,1-5H3/b7-6-/t8-,9-,10?,11?,12-/m0/s1 |
| InChIKey | HNHHOECTALFTDU-YAFQRAMXSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|