C20H16ClN3O3 — CID 121355292
3-chloro-5-[1-[(4-methoxyphenyl)methyl]-4-methyl-6-oxopyrimidin-5-yl]oxybenzonitrile (PubChem CID 121355292) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-chloro-5-[1-[(4-methoxyphenyl)methyl]-4-methyl-6-oxopyrimidin-5-yl]oxybenzonitrile.
| Compound Name | 3-chloro-5-[1-[(4-methoxyphenyl)methyl]-4-methyl-6-oxopyrimidin-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 121355292 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-chloro-5-[1-[(4-methoxyphenyl)methyl]-4-methyl-6-oxopyrimidin-5-yl]oxybenzonitrile |
| SMILES | COc1ccc(Cn2cnc(C)c(Oc3cc(Cl)cc(C#N)c3)c2=O)cc1 |
| InChI | InChI=1S/C20H16ClN3O3/c1-13-19(27-18-8-15(10-22)7-16(21)9-18)20(25)24(12-23-13)11-14-3-5-17(26-2)6-4-14/h3-9,12H,11H2,1-2H3 |
| InChIKey | XOTOFRQUCAZASN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |