C19H19N7OS — CID 121355966
N-[3-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propyl]-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 121355966) has the molecular formula C19H19N7OS and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[3-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propyl]-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propyl]-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 121355966 |
| Molecular Formula | C19H19N7OS |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[3-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propyl]-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(CCCNC(=O)c1csc(-c2ccccc2)n1)c1nccn2cnnc12 |
| InChI | InChI=1S/C19H19N7OS/c1-25(16-17-24-22-13-26(17)11-9-20-16)10-5-8-21-18(27)15-12-28-19(23-15)14-6-3-2-4-7-14/h2-4,6-7,9,11-13H,5,8,10H2,1H3,(H,21,27) |
| InChIKey | NPEBWZQYODDPDC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|