C26H45IO — CID 121356094
(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-17-[(2R)-4-iodobutan-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 121356094) has the molecular formula C26H45IO and a molecular weight of 500.55 g/mol. Its IUPAC name is (3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-17-[(2R)-4-iodobutan-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-17-[(2R)-4-iodobutan-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 121356094 |
| Molecular Formula | C26H45IO |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-17-[(2R)-4-iodobutan-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | CC[C@H]1[C@@H](O)[C@@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)CCI)CC[C@@H]23)[C@@]2(C)CC[C@@H](C)C[C@@H]12 |
| InChI | InChI=1S/C26H45IO/c1-6-18-22-15-16(2)9-12-26(22,5)21-10-13-25(4)19(17(3)11-14-27)7-8-20(25)23(21)24(18)28/h16-24,28H,6-15H2,1-5H3/t16-,17-,18-,19-,20+,21+,22+,23+,24-,25-,26-/m1/s1 |
| InChIKey | PTIAWRJBADPZPG-JDCMAIOWSA-N |
| XLogP | 7.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|