About 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one
2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one (PubChem CID 121356684) has the molecular formula C13H13O4P
and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one.
Molecular Properties
| Compound Name | 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one |
| PubChem CID | 121356684 |
| Molecular Formula | C13H13O4P |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one |
| SMILES | C#CCCCCOP1OC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C13H13O4P/c1-2-3-4-7-10-15-18-16-12-9-6-5-8-11(12)13(14)17-18/h1,5-6,8-9H,3-4,7,10H2 |
| InChIKey | JDZWUUDUQUIBRI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one?
The IUPAC name of 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one (CID 121356684) is 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one.
What is the SMILES notation for 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one?
The canonical SMILES for 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one is C#CCCCCOP1OC(=O)c2ccccc2O1.
What is the InChIKey of 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one?
The InChIKey is JDZWUUDUQUIBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13O4P/c1-2-3-4-7-10-15-18-16-12-9-6-5-8-11(12)13(14)17-18/h1,5-6,8-9H,3-4,7,10H2.
What are the key properties of 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one?
2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one has a molecular weight of 264.22 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-5-ynoxy-1,3,2-benzodioxaphosphinin-4-one is sourced from PubChem (CID 121356684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).