About methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate
methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate (PubChem CID 121357115) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate |
| PubChem CID | 121357115 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate |
| SMILES | COC(=O)CC1=CC=C(C(C)=O)C1 |
| InChI | InChI=1S/C10H12O3/c1-7(11)9-4-3-8(5-9)6-10(12)13-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | SZBFPZFBQYMYRD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate?
The IUPAC name of methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate (CID 121357115) is methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate.
What is the SMILES notation for methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate?
The canonical SMILES for methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate is COC(=O)CC1=CC=C(C(C)=O)C1.
What is the InChIKey of methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate?
The InChIKey is SZBFPZFBQYMYRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7(11)9-4-3-8(5-9)6-10(12)13-2/h3-4H,5-6H2,1-2H3.
What are the key properties of methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate?
methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate has a molecular weight of 180.20 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-acetylcyclopenta-1,3-dien-1-yl)acetate is sourced from PubChem (CID 121357115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).