C25H22NO8S2+ — CID 121357227
4-(6-hydroxy-3-oxa-17-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1,4(9),5,7,10,12,17(21)-heptaen-10-yl)benzene-1,3-disulfonic acid (PubChem CID 121357227) has the molecular formula C25H22NO8S2+ and a molecular weight of 528.58 g/mol. Its IUPAC name is 4-(6-hydroxy-3-oxa-17-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1,4(9),5,7,10,12,17(21)-heptaen-10-yl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(6-hydroxy-3-oxa-17-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1,4(9),5,7,10,12,17(21)-heptaen-10-yl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 121357227 |
| Molecular Formula | C25H22NO8S2+ |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 4-(6-hydroxy-3-oxa-17-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1,4(9),5,7,10,12,17(21)-heptaen-10-yl)benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C2=c3cc4c5c(c3Oc3cc(O)ccc32)CCC[N+]=5CCC4)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C25H21NO8S2/c27-15-5-7-17-21(12-15)34-25-19-4-2-10-26-9-1-3-14(24(19)26)11-20(25)23(17)18-8-6-16(35(28,29)30)13-22(18)36(31,32)33/h5-8,11-13H,1-4,9-10H2,(H2,28,29,30,31,32,33)/p+1 |
| InChIKey | QDWRAMBVYIEPBB-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 141.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|