C20H19F3N8O2 — CID 121357631
(9S)-8-N-(7H-pyrrolo[2,3-d]pyrimidin-2-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121357631) has the molecular formula C20H19F3N8O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is (9S)-8-N-(7H-pyrrolo[2,3-d]pyrimidin-2-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(7H-pyrrolo[2,3-d]pyrimidin-2-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121357631 |
| Molecular Formula | C20H19F3N8O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (9S)-8-N-(7H-pyrrolo[2,3-d]pyrimidin-2-yl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1ncc3cc[nH]c3n1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N8O2/c1-10(20(21,22)23)26-17(32)13-2-3-14-16(27-13)31(12-5-7-30(14)9-12)19(33)29-18-25-8-11-4-6-24-15(11)28-18/h2-4,6,8,10,12H,5,7,9H2,1H3,(H,26,32)(H2,24,25,28,29,33)/t10-,12+/m1/s1 |
| InChIKey | IBHJUJTYJDFOEU-PWSUYJOCSA-N |
| XLogP | 2.66 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |