C16H13F2N5O3 — CID 121358015
8-[(3,5-difluoro-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid (PubChem CID 121358015) has the molecular formula C16H13F2N5O3 and a molecular weight of 361.31 g/mol. Its IUPAC name is 8-[(3,5-difluoro-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid.
| Compound Name | 8-[(3,5-difluoro-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 121358015 |
| Molecular Formula | C16H13F2N5O3 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 8-[(3,5-difluoro-2-pyridinyl)carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(n1)N(C(=O)Nc1ncc(F)cc1F)C1CCN2C1 |
| InChI | InChI=1S/C16H13F2N5O3/c17-8-5-10(18)13(19-6-8)21-16(26)23-9-3-4-22(7-9)12-2-1-11(15(24)25)20-14(12)23/h1-2,5-6,9H,3-4,7H2,(H,24,25)(H,19,21,26) |
| InChIKey | VAXSPTFWBWCRCU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |