C5H8F3NO2 — CID 121358026
N-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]acetamide (PubChem CID 121358026) has the molecular formula C5H8F3NO2 and a molecular weight of 171.12 g/mol. Its IUPAC name is N-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]acetamide.
| Compound Name | N-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 121358026 |
| Molecular Formula | C5H8F3NO2 |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-[(2S)-1,1,1-trifluoro-3-hydroxypropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CO)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2/c1-3(11)9-4(2-10)5(6,7)8/h4,10H,2H2,1H3,(H,9,11)/t4-/m0/s1 |
| InChIKey | PNGRPOQOROIHEZ-BYPYZUCNSA-N |
| XLogP | 0.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |