About N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide
N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide (PubChem CID 121358077) has the molecular formula C6H10F3NO
and a molecular weight of 169.15 g/mol. Its IUPAC name is N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide |
| PubChem CID | 121358077 |
| Molecular Formula | C6H10F3NO |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide |
| SMILES | CC[C@H](NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO/c1-3-5(6(7,8)9)10-4(2)11/h5H,3H2,1-2H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | UEMUEUJHFNUAOR-YFKPBYRVSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide?
The IUPAC name of N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide (CID 121358077) is N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide.
What is the SMILES notation for N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide?
The canonical SMILES for N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide is CC[C@H](NC(C)=O)C(F)(F)F.
What is the InChIKey of N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide?
The InChIKey is UEMUEUJHFNUAOR-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10F3NO/c1-3-5(6(7,8)9)10-4(2)11/h5H,3H2,1-2H3,(H,10,11)/t5-/m0/s1.
What are the key properties of N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide?
N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide has a molecular weight of 169.15 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1,1,1-trifluorobutan-2-yl]acetamide is sourced from PubChem (CID 121358077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).